C12H18ClN3O3S — CID 62169913
5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)benzamide (PubChem CID 62169913) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)benzamide.
| Compound Name | 5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)benzamide |
|---|---|
| PubChem CID | 62169913 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)benzamide |
| SMILES | CCCNc1ccc(Cl)cc1C(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C12H18ClN3O3S/c1-2-5-15-11-4-3-9(13)8-10(11)12(17)16-6-7-20(14,18)19/h3-4,8,15H,2,5-7H2,1H3,(H,16,17)(H2,14,18,19) |
| InChIKey | FDNFTDVKFUXQCX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |