C11H17ClN4O3S — CID 114922305
5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)pyridine-4-carboxamide (PubChem CID 114922305) has the molecular formula C11H17ClN4O3S and a molecular weight of 320.80 g/mol. Its IUPAC name is 5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)pyridine-4-carboxamide.
| Compound Name | 5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114922305 |
| Molecular Formula | C11H17ClN4O3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 5-chloro-2-(propylamino)-N-(2-sulfamoylethyl)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NCCS(N)(=O)=O)c(Cl)cn1 |
| InChI | InChI=1S/C11H17ClN4O3S/c1-2-3-14-10-6-8(9(12)7-16-10)11(17)15-4-5-20(13,18)19/h6-7H,2-5H2,1H3,(H,14,16)(H,15,17)(H2,13,18,19) |
| InChIKey | VFGKYKKIVLDBDH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |