C15H24ClN3O — CID 106331340
5-chloro-N-(3-methylpentan-3-yl)-2-(propylamino)pyridine-4-carboxamide (PubChem CID 106331340) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 5-chloro-N-(3-methylpentan-3-yl)-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(3-methylpentan-3-yl)-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106331340 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 5-chloro-N-(3-methylpentan-3-yl)-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NC(C)(CC)CC)c(Cl)cn1 |
| InChI | InChI=1S/C15H24ClN3O/c1-5-8-17-13-9-11(12(16)10-18-13)14(20)19-15(4,6-2)7-3/h9-10H,5-8H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | HHWPNSRPXHVQOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |