C17H26N2O3 — CID 111461509
3-N-(3-hydroxy-4-methylpentyl)-1-N-propylbenzene-1,3-dicarboxamide (PubChem CID 111461509) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-N-(3-hydroxy-4-methylpentyl)-1-N-propylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(3-hydroxy-4-methylpentyl)-1-N-propylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 111461509 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3-N-(3-hydroxy-4-methylpentyl)-1-N-propylbenzene-1,3-dicarboxamide |
| SMILES | CCCNC(=O)c1cccc(C(=O)NCCC(O)C(C)C)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-9-18-16(21)13-6-5-7-14(11-13)17(22)19-10-8-15(20)12(2)3/h5-7,11-12,15,20H,4,8-10H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | MLINAFNXKISDDO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |