C16H19F3N2O2 — CID 108979741
1-N-(3-methylbutyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108979741) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-N-(3-methylbutyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(3-methylbutyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108979741 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-N-(3-methylbutyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)CCNC(=O)C1(C(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-9(2)5-8-20-14(22)16(6-7-16)15(23)21-11-4-3-10(17)12(18)13(11)19/h3-4,9H,5-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | UVKKHEASCCICJQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|