C16H23F3N4O — CID 110978271
2-[[ethylamino-(3-methylbutylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 110978271) has the molecular formula C16H23F3N4O and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-[[ethylamino-(3-methylbutylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-(3-methylbutylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110978271 |
| Molecular Formula | C16H23F3N4O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-[[ethylamino-(3-methylbutylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCCC(C)C |
| InChI | InChI=1S/C16H23F3N4O/c1-4-20-16(21-8-7-10(2)3)22-9-13(24)23-12-6-5-11(17)14(18)15(12)19/h5-6,10H,4,7-9H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | QVKWUCVCEOCFDR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|