C19H21F4IN4O — CID 111395272
2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111395272) has the molecular formula C19H21F4IN4O and a molecular weight of 524.30 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111395272 |
| Molecular Formula | C19H21F4IN4O |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C19H20F4N4O.HI/c1-2-24-19(25-9-8-12-4-3-5-13(20)10-12)26-11-16(28)27-15-7-6-14(21)17(22)18(15)23;/h3-7,10H,2,8-9,11H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | QYTYVRGRIRCJSP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|