C21H22F3N5O — CID 110996401
2-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 110996401) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110996401 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H22F3N5O/c1-2-25-21(26-10-9-13-11-27-16-6-4-3-5-14(13)16)28-12-18(30)29-17-8-7-15(22)19(23)20(17)24/h3-8,11,27H,2,9-10,12H2,1H3,(H,29,30)(H2,25,26,28) |
| InChIKey | UKSLQQHZQACVFZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|