C20H23F4IN4O2 — CID 111681375
2-[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111681375) has the molecular formula C20H23F4IN4O2 and a molecular weight of 554.33 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111681375 |
| Molecular Formula | C20H23F4IN4O2 |
| Molecular Weight | 554.33 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 2-[[ethylamino-[2-(3-fluorophenoxy)propylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCC(C)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C20H22F4N4O2.HI/c1-3-25-20(26-10-12(2)30-14-6-4-5-13(21)9-14)27-11-17(29)28-16-8-7-15(22)18(23)19(16)24;/h4-9,12H,3,10-11H2,1-2H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | AZCFSEOTTCPYRR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|