C20H29F3N4O2 — CID 111575829
2-[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111575829) has the molecular formula C20H29F3N4O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111575829 |
| Molecular Formula | C20H29F3N4O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[[(2-cycloheptyloxyethylamino)-(ethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCCOC1CCCCCC1 |
| InChI | InChI=1S/C20H29F3N4O2/c1-2-24-20(25-11-12-29-14-7-5-3-4-6-8-14)26-13-17(28)27-16-10-9-15(21)18(22)19(16)23/h9-10,14H,2-8,11-13H2,1H3,(H,27,28)(H2,24,25,26) |
| InChIKey | FQRQGMDXLRHFIP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|