C10H17NO3 — CID 62096934
1-(3-methylbutylcarbamoyl)cyclopropane-1-carboxylic acid (PubChem CID 62096934) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(3-methylbutylcarbamoyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(3-methylbutylcarbamoyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 62096934 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(3-methylbutylcarbamoyl)cyclopropane-1-carboxylic acid |
| SMILES | CC(C)CCNC(=O)C1(C(=O)O)CC1 |
| InChI | InChI=1S/C10H17NO3/c1-7(2)3-6-11-8(12)10(4-5-10)9(13)14/h7H,3-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | MBMYPOSVTVYSSL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|