C20H19F3N2O2 — CID 108982076
1-N-(4-propan-2-ylphenyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108982076) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 1-N-(4-propan-2-ylphenyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-propan-2-ylphenyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982076 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-N-(4-propan-2-ylphenyl)-1-N'-(2,3,4-trifluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)C2(C(=O)Nc3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C20H19F3N2O2/c1-11(2)12-3-5-13(6-4-12)24-18(26)20(9-10-20)19(27)25-15-8-7-14(21)16(22)17(15)23/h3-8,11H,9-10H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | WDQGKLZPSMCVAI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|