C12H15F3N2O2S — CID 111452632
1-(4-hydroxy-1-methylsulfanylbutan-2-yl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 111452632) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-(4-hydroxy-1-methylsulfanylbutan-2-yl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(4-hydroxy-1-methylsulfanylbutan-2-yl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111452632 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-(4-hydroxy-1-methylsulfanylbutan-2-yl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CSCC(CCO)NC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H15F3N2O2S/c1-20-6-7(4-5-18)16-12(19)17-9-3-2-8(13)10(14)11(9)15/h2-3,7,18H,4-6H2,1H3,(H2,16,17,19) |
| InChIKey | ZJHPSFBIRVGBJM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|