C12H16Cl2N2O2S — CID 111452609
1-(3,5-dichlorophenyl)-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea (PubChem CID 111452609) has the molecular formula C12H16Cl2N2O2S and a molecular weight of 323.25 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111452609 |
| Molecular Formula | C12H16Cl2N2O2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(4-hydroxy-1-methylsulfanylbutan-2-yl)urea |
| SMILES | CSCC(CCO)NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O2S/c1-19-7-10(2-3-17)15-12(18)16-11-5-8(13)4-9(14)6-11/h4-6,10,17H,2-3,7H2,1H3,(H2,15,16,18) |
| InChIKey | VNRBMLVUIFURBM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |