C17H15F3N2O3 — CID 108987352
N'-(2-propan-2-yloxyphenyl)-N-(2,3,4-trifluorophenyl)oxamide (PubChem CID 108987352) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N'-(2-propan-2-yloxyphenyl)-N-(2,3,4-trifluorophenyl)oxamide.
| Compound Name | N'-(2-propan-2-yloxyphenyl)-N-(2,3,4-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 108987352 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N'-(2-propan-2-yloxyphenyl)-N-(2,3,4-trifluorophenyl)oxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H15F3N2O3/c1-9(2)25-13-6-4-3-5-11(13)21-16(23)17(24)22-12-8-7-10(18)14(19)15(12)20/h3-9H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | POXUEVCLHLKKMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|