C10H12F3N3 — CID 62379789
2-propan-2-yl-1-(2,3,4-trifluorophenyl)guanidine (PubChem CID 62379789) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is 2-propan-2-yl-1-(2,3,4-trifluorophenyl)guanidine.
| Compound Name | 2-propan-2-yl-1-(2,3,4-trifluorophenyl)guanidine |
|---|---|
| PubChem CID | 62379789 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-propan-2-yl-1-(2,3,4-trifluorophenyl)guanidine |
| SMILES | CC(C)/N=C(\N)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H12F3N3/c1-5(2)15-10(14)16-7-4-3-6(11)8(12)9(7)13/h3-5H,1-2H3,(H3,14,15,16) |
| InChIKey | AQDVVBSYRVZHPJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|