C10H11F3N2O — CID 43312047
2-methyl-3-(2,3,4-trifluoroanilino)propanamide (PubChem CID 43312047) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-methyl-3-(2,3,4-trifluoroanilino)propanamide.
| Compound Name | 2-methyl-3-(2,3,4-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 43312047 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-methyl-3-(2,3,4-trifluoroanilino)propanamide |
| SMILES | CC(CNc1ccc(F)c(F)c1F)C(N)=O |
| InChI | InChI=1S/C10H11F3N2O/c1-5(10(14)16)4-15-7-3-2-6(11)8(12)9(7)13/h2-3,5,15H,4H2,1H3,(H2,14,16) |
| InChIKey | NPWIUKOYFYBAMJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|