C9H10F3N3O — CID 103232798
2-amino-3-(2,3,4-trifluoroanilino)propanamide (PubChem CID 103232798) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-amino-3-(2,3,4-trifluoroanilino)propanamide.
| Compound Name | 2-amino-3-(2,3,4-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 103232798 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-amino-3-(2,3,4-trifluoroanilino)propanamide |
| SMILES | NC(=O)C(N)CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H10F3N3O/c10-4-1-2-6(8(12)7(4)11)15-3-5(13)9(14)16/h1-2,5,15H,3,13H2,(H2,14,16) |
| InChIKey | QARWVKCCOBDAFX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|