C23H35N3O2 — CID 109145889
1-N-cyclopentyl-4-N-[4-(diethylamino)phenyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109145889) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-N-cyclopentyl-4-N-[4-(diethylamino)phenyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-4-N-[4-(diethylamino)phenyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109145889 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-N-cyclopentyl-4-N-[4-(diethylamino)phenyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCC(C(=O)NC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-3-26(4-2)21-15-13-20(14-16-21)25-23(28)18-11-9-17(10-12-18)22(27)24-19-7-5-6-8-19/h13-19H,3-12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | SXQHOGYZAMWQNJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|