C15H13ClF3N3O2 — CID 113020838
ethyl N-[6-[2-chloro-5-(trifluoromethyl)anilino]-3-pyridinyl]carbamate (PubChem CID 113020838) has the molecular formula C15H13ClF3N3O2 and a molecular weight of 359.74 g/mol. Its IUPAC name is ethyl N-[6-[2-chloro-5-(trifluoromethyl)anilino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-[2-chloro-5-(trifluoromethyl)anilino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113020838 |
| Molecular Formula | C15H13ClF3N3O2 |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | ethyl N-[6-[2-chloro-5-(trifluoromethyl)anilino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2cc(C(F)(F)F)ccc2Cl)nc1 |
| InChI | InChI=1S/C15H13ClF3N3O2/c1-2-24-14(23)21-10-4-6-13(20-8-10)22-12-7-9(15(17,18)19)3-5-11(12)16/h3-8H,2H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | RMUKYJOZTQBGTM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |