C20H24ClN3O3 — CID 109162064
azepan-1-yl-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanone (PubChem CID 109162064) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is azepan-1-yl-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanone.
| Compound Name | azepan-1-yl-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109162064 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | azepan-1-yl-[6-(4-chloro-2,5-dimethoxyanilino)-3-pyridinyl]methanone |
| SMILES | COc1cc(Nc2ccc(C(=O)N3CCCCCC3)cn2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O3/c1-26-17-12-16(18(27-2)11-15(17)21)23-19-8-7-14(13-22-19)20(25)24-9-5-3-4-6-10-24/h7-8,11-13H,3-6,9-10H2,1-2H3,(H,22,23) |
| InChIKey | NFJBENPXQWGRNW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |