C19H22ClN3O3 — CID 109166204
[2-(4-chloro-2,5-dimethoxyanilino)-4-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 109166204) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is [2-(4-chloro-2,5-dimethoxyanilino)-4-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [2-(4-chloro-2,5-dimethoxyanilino)-4-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 109166204 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-(4-chloro-2,5-dimethoxyanilino)-4-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | COc1cc(Nc2cc(C(=O)N3CCCCC3)ccn2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O3/c1-25-16-12-15(17(26-2)11-14(16)20)22-18-10-13(6-7-21-18)19(24)23-8-4-3-5-9-23/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,21,22) |
| InChIKey | AEQWZUYNTGCLIA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |