C14H16ClN3O3S — CID 113019129
N-[6-(3-chloro-4-methoxyanilino)-3-pyridinyl]ethanesulfonamide (PubChem CID 113019129) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is N-[6-(3-chloro-4-methoxyanilino)-3-pyridinyl]ethanesulfonamide.
| Compound Name | N-[6-(3-chloro-4-methoxyanilino)-3-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113019129 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[6-(3-chloro-4-methoxyanilino)-3-pyridinyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Nc2ccc(OC)c(Cl)c2)nc1 |
| InChI | InChI=1S/C14H16ClN3O3S/c1-3-22(19,20)18-11-5-7-14(16-9-11)17-10-4-6-13(21-2)12(15)8-10/h4-9,18H,3H2,1-2H3,(H,16,17) |
| InChIKey | DNJHUFHEKMJSGV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |