C20H24Cl2N4O3 — CID 119420166
N-(3-amino-4-methoxyphenyl)-1-(1,3-benzoxazol-2-yl)piperidine-4-carboxamide;dihydrochloride (PubChem CID 119420166) has the molecular formula C20H24Cl2N4O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-1-(1,3-benzoxazol-2-yl)piperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-1-(1,3-benzoxazol-2-yl)piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119420166 |
| Molecular Formula | C20H24Cl2N4O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-1-(1,3-benzoxazol-2-yl)piperidine-4-carboxamide;dihydrochloride |
| SMILES | COc1ccc(NC(=O)C2CCN(c3nc4ccccc4o3)CC2)cc1N.Cl.Cl |
| InChI | InChI=1S/C20H22N4O3.2ClH/c1-26-17-7-6-14(12-15(17)21)22-19(25)13-8-10-24(11-9-13)20-23-16-4-2-3-5-18(16)27-20;;/h2-7,12-13H,8-11,21H2,1H3,(H,22,25);2*1H |
| InChIKey | UHSOYFOHQDBZBQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|