C18H18N4O2 — CID 25337579
1-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylpiperidine-4-carboxamide (PubChem CID 25337579) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylpiperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 25337579 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccncc1)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C18H18N4O2/c23-17(20-14-5-9-19-10-6-14)13-7-11-22(12-8-13)18-21-15-3-1-2-4-16(15)24-18/h1-6,9-10,13H,7-8,11-12H2,(H,19,20,23) |
| InChIKey | VTIWYDGDODQCOR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |