C19H18IN3O2 — CID 16590448
1-(1,3-benzoxazol-2-yl)-N-(2-iodophenyl)piperidine-4-carboxamide (PubChem CID 16590448) has the molecular formula C19H18IN3O2 and a molecular weight of 447.28 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-(2-iodophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-(2-iodophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16590448 |
| Molecular Formula | C19H18IN3O2 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-(2-iodophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1I)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C19H18IN3O2/c20-14-5-1-2-6-15(14)21-18(24)13-9-11-23(12-10-13)19-22-16-7-3-4-8-17(16)25-19/h1-8,13H,9-12H2,(H,21,24) |
| InChIKey | KXJDRWRWWTUAGZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|