C20H21N3O3 — CID 17423416
1-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 17423416) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17423416 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-(2-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C20H21N3O3/c1-25-17-8-4-2-6-15(17)21-19(24)14-10-12-23(13-11-14)20-22-16-7-3-5-9-18(16)26-20/h2-9,14H,10-13H2,1H3,(H,21,24) |
| InChIKey | VZLPNIJMGZQNNA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |