C16H22F2N2O5S — CID 18280720
N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-ethylsulfonylpiperidine-4-carboxamide (PubChem CID 18280720) has the molecular formula C16H22F2N2O5S and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-ethylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-ethylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 18280720 |
| Molecular Formula | C16H22F2N2O5S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-ethylsulfonylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)Nc2ccc(OC)c(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C16H22F2N2O5S/c1-3-26(22,23)20-8-6-11(7-9-20)15(21)19-12-4-5-13(24-2)14(10-12)25-16(17)18/h4-5,10-11,16H,3,6-9H2,1-2H3,(H,19,21) |
| InChIKey | NURVVNAUOHWQNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |