C19H23Cl2N5O2 — CID 162727955
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide (PubChem CID 162727955) has the molecular formula C19H23Cl2N5O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 162727955 |
| Molecular Formula | C19H23Cl2N5O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)Cn3ncc(Cl)c(Cl)c3=O)c(C)c2)CC1 |
| InChI | InChI=1S/C19H23Cl2N5O2/c1-3-24-6-8-25(9-7-24)14-4-5-16(13(2)10-14)23-17(27)12-26-19(28)18(21)15(20)11-22-26/h4-5,10-11H,3,6-9,12H2,1-2H3,(H,23,27) |
| InChIKey | RRQAZRCCXUXPOU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|