C22H22ClN3O2S — CID 39267184
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide (PubChem CID 39267184) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 39267184 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc(N2CCOCC2)ccc1NC(=O)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-15-12-17(26-8-10-28-11-9-26)6-7-20(15)25-21(27)13-16-14-29-22(24-16)18-4-2-3-5-19(18)23/h2-7,12,14H,8-11,13H2,1H3,(H,25,27) |
| InChIKey | JZDVBUBKQPAELY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|