C16H27N3O3S — CID 119688794
(2S)-2-amino-N-[3-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 119688794) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[3-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119688794 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2S)-2-amino-N-[3-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)[C@@H](N)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27N3O3S/c1-15(2,3)13(17)14(20)18-11-8-7-9-12(10-11)23(21,22)19-16(4,5)6/h7-10,13,19H,17H2,1-6H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | JBKJMDDCJLHONC-CYBMUJFWSA-N |
| XLogP | 2.08 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |