C21H27ClN2O3S — CID 9371847
(2R)-N-[3-(tert-butylsulfamoyl)phenyl]-2-(4-chlorophenyl)-3-methylbutanamide (PubChem CID 9371847) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is (2R)-N-[3-(tert-butylsulfamoyl)phenyl]-2-(4-chlorophenyl)-3-methylbutanamide.
| Compound Name | (2R)-N-[3-(tert-butylsulfamoyl)phenyl]-2-(4-chlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 9371847 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2R)-N-[3-(tert-butylsulfamoyl)phenyl]-2-(4-chlorophenyl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)Nc1cccc(S(=O)(=O)NC(C)(C)C)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN2O3S/c1-14(2)19(15-9-11-16(22)12-10-15)20(25)23-17-7-6-8-18(13-17)28(26,27)24-21(3,4)5/h6-14,19,24H,1-5H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | CUJWDAJSBDQAMK-LJQANCHMSA-N |
| XLogP | 4.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |