C13H17N3O2S — CID 63873096
3-(3,5-dimethylpiperazin-1-yl)sulfonylbenzonitrile (PubChem CID 63873096) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperazin-1-yl)sulfonylbenzonitrile.
| Compound Name | 3-(3,5-dimethylpiperazin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 63873096 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-(3,5-dimethylpiperazin-1-yl)sulfonylbenzonitrile |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C#N)c2)CC(C)N1 |
| InChI | InChI=1S/C13H17N3O2S/c1-10-8-16(9-11(2)15-10)19(17,18)13-5-3-4-12(6-13)7-14/h3-6,10-11,15H,8-9H2,1-2H3 |
| InChIKey | RQVGFDYSOYPFRD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |