C17H23FN2O4S — CID 156612065
2-(3-fluorophenyl)sulfonyl-6-oxa-2,9-diazabicyclo[9.3.0]tetradecan-10-one (PubChem CID 156612065) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(3-fluorophenyl)sulfonyl-6-oxa-2,9-diazabicyclo[9.3.0]tetradecan-10-one.
| Compound Name | 2-(3-fluorophenyl)sulfonyl-6-oxa-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
|---|---|
| PubChem CID | 156612065 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(3-fluorophenyl)sulfonyl-6-oxa-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
| SMILES | O=C1NCCOCCCN(S(=O)(=O)c2cccc(F)c2)C2CCCC12 |
| InChI | InChI=1S/C17H23FN2O4S/c18-13-4-1-5-14(12-13)25(22,23)20-9-3-10-24-11-8-19-17(21)15-6-2-7-16(15)20/h1,4-5,12,15-16H,2-3,6-11H2,(H,19,21) |
| InChIKey | GPUDNLWUAMTEBS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |