C15H18FN2O2S2+ — CID 7029027
1-[(2-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium (PubChem CID 7029027) has the molecular formula C15H18FN2O2S2+ and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium.
| Compound Name | 1-[(2-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 7029027 |
| Molecular Formula | C15H18FN2O2S2+ |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium |
| SMILES | O=S(=O)(c1cccs1)N1CC[NH+](Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C15H17FN2O2S2/c16-14-5-2-1-4-13(14)12-17-7-9-18(10-8-17)22(19,20)15-6-3-11-21-15/h1-6,11H,7-10,12H2/p+1 |
| InChIKey | BMWBPFVATPBHJD-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |