C16H20FN2O2S3+ — CID 8553395
1-[2-(2-fluorophenyl)sulfanylethyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium (PubChem CID 8553395) has the molecular formula C16H20FN2O2S3+ and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)sulfanylethyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium.
| Compound Name | 1-[2-(2-fluorophenyl)sulfanylethyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 8553395 |
| Molecular Formula | C16H20FN2O2S3+ |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-[2-(2-fluorophenyl)sulfanylethyl]-4-thiophen-2-ylsulfonylpiperazin-1-ium |
| SMILES | O=S(=O)(c1cccs1)N1CC[NH+](CCSc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H19FN2O2S3/c17-14-4-1-2-5-15(14)22-13-11-18-7-9-19(10-8-18)24(20,21)16-6-3-12-23-16/h1-6,12H,7-11,13H2/p+1 |
| InChIKey | MSFAWTAWGHSLBB-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |