C15H27N3O4S2+2 — CID 9449991
(2R)-1-morpholin-4-ium-4-yl-3-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propan-2-ol (PubChem CID 9449991) has the molecular formula C15H27N3O4S2+2 and a molecular weight of 377.53 g/mol. Its IUPAC name is (2R)-1-morpholin-4-ium-4-yl-3-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propan-2-ol.
| Compound Name | (2R)-1-morpholin-4-ium-4-yl-3-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 9449991 |
| Molecular Formula | C15H27N3O4S2+2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2R)-1-morpholin-4-ium-4-yl-3-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propan-2-ol |
| SMILES | O=S(=O)(c1cccs1)N1CC[NH+](C[C@@H](O)C[NH+]2CCOCC2)CC1 |
| InChI | InChI=1S/C15H25N3O4S2/c19-14(13-17-7-9-22-10-8-17)12-16-3-5-18(6-4-16)24(20,21)15-2-1-11-23-15/h1-2,11,14,19H,3-10,12-13H2/p+2/t14-/m1/s1 |
| InChIKey | ALUMQRGXNOVDMT-CQSZACIVSA-P |
| XLogP | -3.09 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |