C16H21N2O3S2+ — CID 8844908
N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]thiophene-2-sulfonamide (PubChem CID 8844908) has the molecular formula C16H21N2O3S2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 8844908 |
| Molecular Formula | C16H21N2O3S2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@H](C[NH+]1CCOCC1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C16H20N2O3S2/c19-23(20,16-7-4-12-22-16)17-15(14-5-2-1-3-6-14)13-18-8-10-21-11-9-18/h1-7,12,15,17H,8-11,13H2/p+1/t15-/m1/s1 |
| InChIKey | OWFLYQQVCBPSJP-OAHLLOKOSA-O |
| XLogP | 0.68 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |