C22H31N2O3S+ — CID 8845032
4-tert-butyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide (PubChem CID 8845032) has the molecular formula C22H31N2O3S+ and a molecular weight of 403.57 g/mol. Its IUPAC name is 4-tert-butyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8845032 |
| Molecular Formula | C22H31N2O3S+ |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-tert-butyl-N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N[C@H](C[NH+]2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H30N2O3S/c1-22(2,3)19-9-11-20(12-10-19)28(25,26)23-21(18-7-5-4-6-8-18)17-24-13-15-27-16-14-24/h4-12,21,23H,13-17H2,1-3H3/p+1/t21-/m1/s1 |
| InChIKey | CIPAEYUTOAPEBL-OAQYLSRUSA-O |
| XLogP | 1.92 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |