C18H23N2O3S+ — CID 8844896
N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide (PubChem CID 8844896) has the molecular formula C18H23N2O3S+ and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide.
| Compound Name | N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8844896 |
| Molecular Formula | C18H23N2O3S+ |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[(1S)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H](C[NH+]1CCOCC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3S/c21-24(22,17-9-5-2-6-10-17)19-18(16-7-3-1-4-8-16)15-20-11-13-23-14-12-20/h1-10,18-19H,11-15H2/p+1/t18-/m1/s1 |
| InChIKey | GIZSCLWKDSATET-GOSISDBHSA-O |
| XLogP | 0.62 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |