C20H27N2O3S+ — CID 8844996
3,4-dimethyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide (PubChem CID 8844996) has the molecular formula C20H27N2O3S+ and a molecular weight of 375.51 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8844996 |
| Molecular Formula | C20H27N2O3S+ |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3,4-dimethyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)cc1C |
| InChI | InChI=1S/C20H26N2O3S/c1-16-8-9-19(14-17(16)2)26(23,24)21-20(18-6-4-3-5-7-18)15-22-10-12-25-13-11-22/h3-9,14,20-21H,10-13,15H2,1-2H3/p+1/t20-/m0/s1 |
| InChIKey | ZFRFFCRHKUNPRY-FQEVSTJZSA-O |
| XLogP | 1.24 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |