C13H20N2O4S2 — CID 124992631
(3S)-3-(morpholin-4-ylmethyl)-1-thiophen-2-ylsulfonylpyrrolidin-3-ol (PubChem CID 124992631) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is (3S)-3-(morpholin-4-ylmethyl)-1-thiophen-2-ylsulfonylpyrrolidin-3-ol.
| Compound Name | (3S)-3-(morpholin-4-ylmethyl)-1-thiophen-2-ylsulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 124992631 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (3S)-3-(morpholin-4-ylmethyl)-1-thiophen-2-ylsulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1cccs1)N1CC[C@](O)(CN2CCOCC2)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c16-13(10-14-5-7-19-8-6-14)3-4-15(11-13)21(17,18)12-2-1-9-20-12/h1-2,9,16H,3-8,10-11H2/t13-/m0/s1 |
| InChIKey | PRYVMVIJJVIKIY-ZDUSSCGKSA-N |
| XLogP | 0.21 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |