C16H20N2O3S2 — CID 94136143
N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 94136143) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 94136143 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cccc(CN2CCOCC2)c1)c1cccs1 |
| InChI | InChI=1S/C16H20N2O3S2/c19-23(20,16-5-2-10-22-16)17-12-14-3-1-4-15(11-14)13-18-6-8-21-9-7-18/h1-5,10-11,17H,6-9,12-13H2 |
| InChIKey | TWCOBANAISFRMZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |