C22H25N3O3S — CID 55816008
3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]quinoline-8-sulfonamide (PubChem CID 55816008) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]quinoline-8-sulfonamide.
| Compound Name | 3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 55816008 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]quinoline-8-sulfonamide |
| SMILES | Cc1cnc2c(S(=O)(=O)NCc3cccc(CN4CCOCC4)c3)cccc2c1 |
| InChI | InChI=1S/C22H25N3O3S/c1-17-12-20-6-3-7-21(22(20)23-14-17)29(26,27)24-15-18-4-2-5-19(13-18)16-25-8-10-28-11-9-25/h2-7,12-14,24H,8-11,15-16H2,1H3 |
| InChIKey | FNXZVGPLWBOWJN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |