C17H20ClN3O3S — CID 55872974
6-chloro-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyridine-3-sulfonamide (PubChem CID 55872974) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 6-chloro-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55872974 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 6-chloro-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1cccc(CN2CCOCC2)c1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H20ClN3O3S/c18-17-5-4-16(12-19-17)25(22,23)20-11-14-2-1-3-15(10-14)13-21-6-8-24-9-7-21/h1-5,10,12,20H,6-9,11,13H2 |
| InChIKey | UUNNNLRSXJOASK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|