C14H18N4O3S2 — CID 91966940
N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide (PubChem CID 91966940) has the molecular formula C14H18N4O3S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91966940 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(N2CCOCC2)nc(CNS(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C14H18N4O3S2/c1-11-9-13(18-4-6-21-7-5-18)17-12(16-11)10-15-23(19,20)14-3-2-8-22-14/h2-3,8-9,15H,4-7,10H2,1H3 |
| InChIKey | RROIXHXBUIGWSG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |