C14H17BrN4O2S2 — CID 122317962
5-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide (PubChem CID 122317962) has the molecular formula C14H17BrN4O2S2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 5-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122317962 |
| Molecular Formula | C14H17BrN4O2S2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 5-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(N2CCCC2)nc(CNS(=O)(=O)c2ccc(Br)s2)n1 |
| InChI | InChI=1S/C14H17BrN4O2S2/c1-10-8-13(19-6-2-3-7-19)18-12(17-10)9-16-23(20,21)14-5-4-11(15)22-14/h4-5,8,16H,2-3,6-7,9H2,1H3 |
| InChIKey | FDILBDNFWJPMOA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |