C17H25N5O5S — CID 122319174
2-(2,6-dioxopiperidin-1-yl)-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide (PubChem CID 122319174) has the molecular formula C17H25N5O5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-1-yl)-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-1-yl)-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 122319174 |
| Molecular Formula | C17H25N5O5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-(2,6-dioxopiperidin-1-yl)-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide |
| SMILES | Cc1cc(N2CCOCC2)nc(CNS(=O)(=O)CCN2C(=O)CCCC2=O)n1 |
| InChI | InChI=1S/C17H25N5O5S/c1-13-11-15(21-5-8-27-9-6-21)20-14(19-13)12-18-28(25,26)10-7-22-16(23)3-2-4-17(22)24/h11,18H,2-10,12H2,1H3 |
| InChIKey | OYPZOJZRNWWGSC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|