C16H23N5O5S — CID 122318899
2-(2,6-dioxopiperidin-1-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide (PubChem CID 122318899) has the molecular formula C16H23N5O5S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-1-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-1-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 122318899 |
| Molecular Formula | C16H23N5O5S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-1-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]ethanesulfonamide |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)NCc1nccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H23N5O5S/c22-15-2-1-3-16(23)21(15)8-11-27(24,25)18-12-13-17-5-4-14(19-13)20-6-9-26-10-7-20/h4-5,18H,1-3,6-12H2 |
| InChIKey | WUAVNCQLTVBEOE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|