C13H18N6O3S — CID 122318932
1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]imidazole-4-sulfonamide (PubChem CID 122318932) has the molecular formula C13H18N6O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]imidazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122318932 |
| Molecular Formula | C13H18N6O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCc2nccc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C13H18N6O3S/c1-18-9-13(15-10-18)23(20,21)16-8-11-14-3-2-12(17-11)19-4-6-22-7-5-19/h2-3,9-10,16H,4-8H2,1H3 |
| InChIKey | SHDLFZXGVDSNJO-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |